Molecular Formula: | |
---|---|
Molecular Formula | C27H38N2O3 |
Molecular Weight: | |
Molecular Weight | 438.6 |
COA: | |
COA | Inquire |
Targets: | |
Targets | Cytochrome P450 | Interleukin Related |
Description: | |
Description | Veledimex racemate is the racemate of veledimex. Veledimex is an orally active small molecule diacylhydrazine and controls the expression of the target gene. |
Synonyms: | |
---|---|
Synonyms | N'-(3,5-dimethylbenzoyl)-N'-(2,2-dimethylhexan-3-yl)-2-ethyl-3-methoxybenzohydrazide; Veledimex (racemate) |
Solubility: | |
Solubility | DMSO: 10 mM |
Storage: | |
Storage | Store in a cool and dry place (or refer to the Certificate of Analysis). |
MSDS: | |
MSDS | Inquire |
Density: | |
---|---|
Density | 1.048±0.06 g/cm3 |
InChIKey: | |
InChIKey | LZWZPGLVHLSWQX-UHFFFAOYSA-N |
InChI: | |
InChI | 1S/C27H38N2O3/c1-9-12-24(27(5,6)7)29(26(31)20-16-18(3)15-19(4)17-20)28-25(30)22-13-11-14-23(32-8)21(22)10-2/h11,13-17,24H,9-10,12H2,1-8H3,(H,28,30) |
Canonical SMILES: | |
Canonical SMILES | CCCC(C(C)(C)C)N(C(=O)C1=CC(=CC(=C1)C)C)NC(=O)C2=C(C(=CC=C2)OC)CC |
Chemical Structure