Molecular Formula: | |
---|---|
Molecular Formula | C17H26ClNO |
Molecular Weight: | |
Molecular Weight | 295.85 |
COA: | |
COA | Inquire |
Targets: | |
Targets | Histamine Receptor |
Description: | |
Description | Tiprolisant is potent and selective nonimidazole inverse agonist at the histamine H3 receptor. (Ki=0.16 nM). |
Purity: | |
---|---|
Purity | ≥95% |
Appearance: | |
Appearance | Solid powder |
Synonyms: | |
Synonyms | Pitolisant; 1-[3-[3-(4-chlorophenyl)propoxy]propyl]piperidine; |
Solubility: | |
Solubility | Soluble in DMSO |
Storage: | |
Storage | Store at -20 °C |
MSDS: | |
MSDS | Inquire |
Application: | |
Application | The histamine H3 receptor. |
Quality Standard: | |
Quality Standard | Enterprise Standard |
Shelf Life: | |
Shelf Life | As supplied, 2 years from the QC date provided on the Certificate of Analysis, when stored properly |
Quantity: | |
---|---|
Quantity | Milligrams-Grams |
InChIKey: | |
InChIKey | NNACHAUCXXVJSP-UHFFFAOYSA-N |
InChI: | |
InChI | 1S/C17H26ClNO/c18-17-9-7-16(8-10-17)6-4-14-20-15-5-13-19-11-2-1-3-12-19/h7-10H,1-6,11-15H2 |
Canonical SMILES: | |
Canonical SMILES | C1CCN(CC1)CCCOCCCC2=CC=C(C=C2)Cl |
Current Developer: | |
Current Developer | Bioprojet |
Chemical Structure