| Molecular Formula: | |
|---|---|
| Molecular Formula | C17H26ClNO |
| Molecular Weight: | |
| Molecular Weight | 295.85 |
| COA: | |
| COA | Inquire |
| Targets: | |
| Targets | Histamine Receptor |
| Description: | |
| Description | Tiprolisant is potent and selective nonimidazole inverse agonist at the histamine H3 receptor. (Ki=0.16 nM). |
| Purity: | |
|---|---|
| Purity | ≥95% |
| Appearance: | |
| Appearance | Solid powder |
| Synonyms: | |
| Synonyms | Pitolisant; 1-[3-[3-(4-chlorophenyl)propoxy]propyl]piperidine; |
| Solubility: | |
| Solubility | Soluble in DMSO |
| Storage: | |
| Storage | Store at -20 °C |
| MSDS: | |
| MSDS | Inquire |
| Application: | |
| Application | The histamine H3 receptor. |
| Quality Standard: | |
| Quality Standard | Enterprise Standard |
| Shelf Life: | |
| Shelf Life | As supplied, 2 years from the QC date provided on the Certificate of Analysis, when stored properly |
| Quantity: | |
|---|---|
| Quantity | Milligrams-Grams |
| InChIKey: | |
| InChIKey | NNACHAUCXXVJSP-UHFFFAOYSA-N |
| InChI: | |
| InChI | 1S/C17H26ClNO/c18-17-9-7-16(8-10-17)6-4-14-20-15-5-13-19-11-2-1-3-12-19/h7-10H,1-6,11-15H2 |
| Canonical SMILES: | |
| Canonical SMILES | C1CCN(CC1)CCCOCCCC2=CC=C(C=C2)Cl |
| Current Developer: | |
| Current Developer | Bioprojet |
Cetirizine diHCl
(CAS: 83881-52-1)
Cetirizine is a major metabolite of hydroxyzine, and a racemic selective H1 receptor antagonist.
Carebastine
(CAS: 90729-42-3)
Carebastine is the active first-pass metabolite of Ebastine. Carebastine acts as a selective histamine H1 receptor antagonist that has the potential for allergy...
Dramamine
(CAS: 523-87-5)
Dimenhydrinate is an over-the-counter antiemetic used to prevent nausea and motion sicknes composed of 8-Chlorotheophylline and Diphenhydramine.
Impentamine dihydrobromide
(CAS: 149629-70-9)
Impentamine dihydrobromide is the dihydrobromide salt of impentamine, which is a highly selective and the most potent histamine H3 antagonist with pA2 value of ...
Loratadine
(CAS: 79794-75-5)
Loratadine is a histamine H1 receptor antagonist, used to treat allergies. It also acts as a selective inhibitor of B(0)AT2 with IC50 of 4 μM.
JNJ 10191584 maleate
(CAS: 869497-75-6)
The maleate salt form of JNJ 10191584, which has been found to be a selective histamine H4 receptor silent antagonist and could restrain mast cell and eosinophi...
Dimethindene
(CAS: 5636-83-9)
Dimethindene is a selective histamine H1 antagonist. It binds to the histamine H1 receptor. It is an antiallergic drug and is used in hypersensitivity reactions...
HTMT dimaleate
(CAS: 195867-54-0)
HTMT dimaleate is a histamine H1 and H2 receptor agonist with 4x104 fold activity over histamine in H2-mediated effects in natural suppressor cells. HTMT dimale...
Chemical Structure
