| Molecular Formula: | |
|---|---|
| Molecular Formula | C23H35ClN4OS |
| Molecular Weight: | |
| Molecular Weight | 451.07 |
| COA: | |
| COA | Inquire |
| Targets: | |
| Targets | Dopamine Receptor |
| Description: | |
| Description | ST-836 hydrochloride, the hydrochloride salt form of verubulin, a dopamine receptor ligand that antiparkinsonian effect. |
| Appearance: | |
|---|---|
| Appearance | White to off-white solid |
| Synonyms: | |
| Synonyms | ST836 hydrochloride; ST 836 hydrochloride; N-[2-[4-(2-methoxyphenyl)piperazin-1-yl]ethyl]-N-propyl-4,5,6,7-tetrahydro-1,3-benzothiazol-6-amine;hydrochlorideST-836 (hydrochloride)1415564-68-9C23H34N4OS.ClHDTXSID107353513876AHHY-15238ACS-0920; CS 0920; CS0920W-5910; W 5910; W5910N-(2-(4-(2-Methoxyphenyl)piperazin-1-yl)eth |
| Solubility: | |
| Solubility | Soluble to 10 mM in DMSO |
| Storage: | |
| Storage | Store in a cool and dry place and at 0 - 4℃ for short term (days to weeks) or -23℃ for long term (months to years). |
| MSDS: | |
| MSDS | Inquire |
| Shelf Life: | |
| Shelf Life | 2 years |
| Quantity: | |
|---|---|
| Quantity | Grams-Kilos |
| InChIKey: | |
| InChIKey | FQDNEMILQYIEIG-UHFFFAOYSA-N |
| InChI: | |
| InChI | 1S/C23H34N4OS.ClH/c1-3-10-26(19-8-9-20-23(17-19)29-18-24-20)14-11-25-12-15-27(16-13-25)21-6-4-5-7-22(21)28-2;/h4-7,18-19H,3,8-17H2,1-2H3;1H |
| Canonical SMILES: | |
| Canonical SMILES | CCCN(CCN1CCN(CC1)C2=CC=CC=C2OC)C3CCC4=C(C3)SC=N4.Cl |
thiethylperazine
(CAS: 1420-55-9)
Thiethylperazine is a dopamine receptor antagonist It is an antiemetic of the phenothiazine class. Though it was never licensed or used as an antipsychotic, it ...
Neuromedin N
(CAS: 92169-45-4)
Neuromedin N is a potent modulator of dopamine D2 receptor agonist which binds in rat neostriatal membranes. It produced a significant concentration-related inc...
(+)-PD 128907 hydrochloride
(CAS: 300576-59-4)
(+)-PD 128907 hydrochloride, the more active enantiomer of trans-(±)-PD 128907, is a potent D3 dopamine receptor agonist (Ki = 2.3 nM), with 18-200-fold selecti...
(S)-5-Methoxy-N-propyl-2-aminotetraline
(CAS: 93601-86-6)
(S)-5-Methoxy-N-propyl-2-Aminotetraline hydrochloride is a dopamine receptor agonist.
SB 277011A dihydrochloride
(CAS: 1226917-67-4)
SB 277011A dihydrochloride is a selective and brain penetrating dopamine D3 receptor antagonist (pKi = 8.0, 6.0, 5.0 and <5.2 for D3, D2, 5-HT1D and 5-HT1B, res...
Oxidopamine hydrochloride
(CAS: 28094-15-7)
Oxidopamine hydrochloride, also called as 6-OHDA, is a selective catecholaminergic neurotoxin that selectively destroy dopaminergic and noradrenergic neurons in...
Molindone hydrochloride
(CAS: 15622-65-8)
Molindone hydrochloride, an indole derivative, as an antipsychotic agent it blocks the effects of dopamine in the brain which can be used for the treatment of s...
Iloperidone hydrochloride
(CAS: 1299470-39-5)
The hydrochloride salt form of Iloperidone which is a antagonist of both D2 and 5-HT2 receptor and has been commonly used against schizophrenia. IC50: 10-100 nm...
