| Molecular Formula: | |
|---|---|
| Molecular Formula | C11H16N2O2 |
| Molecular Weight: | |
| Molecular Weight | 208.261 |
| COA: | |
| COA | Inquire |
| Description: | |
| Description | (R)-2-Amino-N-benzyl-3-methoxypropanamide is an impurity of lacosamide, which is a medication used for the treatment of partial-onset seizures and diabetic neuropathic pain. |
| Catalog Number | Size | Price | Stock | Quantity |
|---|---|---|---|---|
| B1277-268197 | 1 g | $199 | In stock |
| Appearance: | |
|---|---|
| Appearance | Off-White Low-Melting Solid |
| Synonyms: | |
| Synonyms | (2R)-2-Amino-N-benzyl-3-methoxypropanamide; N-benzyl-O-methyl-D-serinamide; N-Desacetyl Lacosamide |
| MSDS: | |
| MSDS | Inquire |
| InChIKey: | |
|---|---|
| InChIKey | WPLANNRKFDHEKD-SNVBAGLBSA-N |
| InChI: | |
| InChI | InChI=1S/C11H16N2O2/c1-15-8-10(12)11(14)13-7-9-5-3-2-4-6-9/h2-6,10H,7-8,12H2,1H3,(H,13,14)/t10-/m1/s1 |
| Canonical SMILES: | |
| Canonical SMILES | COCC(C(=O)NCC1=CC=CC=C1)N |
Lacosamide Impurity 1
(CAS: 86921-49-5)
an impurity of Lacosamide which is a medication used for the adjunctive treatment of partial-onset seizures and diabetic neuropathic pain and is a potent antico...
Desacetyl Desmethyl Lacosamide
(CAS: 175481-39-7)
an impurity of Lacosamide which is a potent anticonvulsant.
(S)-Lacosamide
(CAS: 175481-37-5)
an impurity of Lacosamide, a medication used for the adjunctive treatment of partial-onset seizures and diabetic neuropathic pain.
Desmethyl Lacosamide
(CAS: 175481-38-6)
a mediication developed as and adjunctive treatment of partial-onset seizures and diabetic neuropthic pain.Lacosamide is a potent anticonvulsant.
N-Desacetyl Lacosamide HCl
(CAS: 1322062-76-9)
Chemical Structure
