| Molecular Formula: | |
|---|---|
| Molecular Formula | C21H21F3N2O3 |
| Molecular Weight: | |
| Molecular Weight | 406.4 |
| COA: | |
| COA | Inquire |
| Targets: | |
| Targets | DHODH |
| Description: | |
| Description | ML-390 is an inhibitor of human DHODH, which induces differentiation in acute myeloid leukemia cell lines U937 (murine) and THP-1 (human) cell lines with an EC50 value of approximately 2 µM. |
| Catalog Number | Size | Price | Stock | Quantity |
|---|---|---|---|---|
| B0084-008137 | 100 mg | $998 | In stock |
| Purity: | |
|---|---|
| Purity | 99% |
| Synonyms: | |
| Synonyms | N-[3-Oxo-3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]propyl]-4-(trifluoromethoxy)benzamide |
| Solubility: | |
| Solubility | Soluble to 81 mg/mL in DMSO. |
| Storage: | |
| Storage | Store in a cool and dry place (or refer to the Certificate of Analysis). |
| MSDS: | |
| MSDS | Inquire |
| Boiling Point: | |
|---|---|
| Boiling Point | 599.7±50.0 °C at 760 mmHg |
| Density: | |
| Density | 1.31±0.1 g/cm3 |
| InChIKey: | |
| InChIKey | SGNRHEDBLPGDDC-GOSISDBHSA-N |
| InChI: | |
| InChI | InChI=1S/C21H21F3N2O3/c22-21(23,24)29-16-10-8-15(9-11-16)20(28)25-13-12-19(27)26-18-7-3-5-14-4-1-2-6-17(14)18/h1-2,4,6,8-11,18H,3,5,7,12-13H2,(H,25,28)(H,26,27)/t18-/m1/s1 |
| Canonical SMILES: | |
| Canonical SMILES | C1CC(C2=CC=CC=C2C1)NC(=O)CCNC(=O)C3=CC=C(C=C3)OC(F)(F)F |
Brequinar sodium
(CAS: 96201-88-6)
Brequinar sodium is a potent and selective dihydroorotate dehydrogenase (DHODH) inhibitor (IC50 = ~20 nM), which causes the blockade of de novo pyrimidine nucle...
DSM265
(CAS: 1282041-94-4)
DSM265 is a selective DHODH (dihydroorotate dehydrogenase) inhibitor used for prevention and treatment of malaria. DSM265 is highly selective toward DHODH of th...
ML390
(CAS: 2029049-79-2)
ML-390 is an inhibitor of human DHODH, which induces differentiation in acute myeloid leukemia cell lines U937 (murine) and THP-1 (human) cell lines with an EC5...
Chemical Structure
