Molecular Formula: | |
---|---|
Molecular Formula | C9H11Cl2N |
Molecular Weight: | |
Molecular Weight | 204.09 |
COA: | |
COA | Inquire |
Targets: | |
Targets | Others |
Description: | |
Description | MDL-72274 is a selective SSAO inhibitor. It is a potent (IC50 = 10(-9) M) inhibitor of both MAO-B and SSAO, with 190-fold lower affinity for MAO-A. MDL-72974 can be used for the treatment of Parkinson diseases. |
Purity: | |
---|---|
Purity | 98% |
Appearance: | |
Appearance | Powder |
Synonyms: | |
Synonyms | (E)-3-chloro-2-phenylprop-2-en-1-amine hydrochloride |
Solubility: | |
Solubility | Soluble in DMSO |
Storage: | |
Storage | -20℃ Freezer |
MSDS: | |
MSDS | Inquire |
Application: | |
Application | Parkinson diseases |
Quality Standard: | |
Quality Standard | In-house standard |
Shelf Life: | |
Shelf Life | 2 month in rt, long time |
Quantity: | |
---|---|
Quantity | Milligrams-Grams |
Canonical SMILES: | |
Canonical SMILES | NC/C(C1=CC=CC=C1)=C/Cl.[H]Cl |