Molecular Formula: | |
---|---|
Molecular Formula | C33H50Cl2N2O6 |
Molecular Weight: | |
Molecular Weight | 641.67 |
COA: | |
COA | Inquire |
Targets: | |
Targets | Others |
Description: | |
Description | K-7174, one of proteasome inhibitory homopiperazine derivatives, exhibits a therapeutic effect, which is stronger when administered orally than intravenously, without obvious side effects in a murine myeloma model. Moreover, K-7174 kills bortezomib-resistant myeloma cells carrying a β5-subunit mutation in vivo and primary cells from a patient resistant to bortezomib. |
Purity: | |
---|---|
Purity | >98% |
Related CAS: | |
Related CAS | 191089-59-5 (Free base) |
Appearance: | |
Appearance | White to off-white solid powder |
Synonyms: | |
Synonyms | 1,4-bis((E)-5-(3,4,5-trimethoxyphenyl)pent-4-en-1-yl)-1,4-diazepane dihydrochloride; K7174; K 7174; K-7174; K-7174-2HCl; K-7174 dihydrochloride |
MSDS: | |
MSDS | Inquire |
InChIKey: | |
---|---|
InChIKey | JKAQFPBRMVEHBD-CHBZAFCASA-N |
InChI: | |
InChI | 1S/C33H48N2O6.2ClH/c1-36-28-22-26(23-29(37-2)32(28)40-5)14-9-7-11-16-34-18-13-19-35(21-20-34)17-12-8-10-15-27-24-30(38-3)33(41-6)31(25-27)39-4;;/h9-10,14-15,22-25H,7-8,11-13,16-21H2,1-6H3;2*1H/b14-9+,15-10+;; |
Canonical SMILES: | |
Canonical SMILES | COC1=C(OC)C(OC)=CC(/C=C/CCCN2CCN(CCC/C=C/C3=CC(OC)=C(OC)C(OC)=C3)CCC2)=C1.[H]Cl.[H]Cl |
Chemical Structure