| Molecular Formula: | |
|---|---|
| Molecular Formula | C25H23ClN6 |
| Molecular Weight: | |
| Molecular Weight | 442.94 |
| COA: | |
| COA | Inquire |
| Application\Fluorophore: | |
| Application\Fluorophore | DNA Stains |
| Description: | |
| Description | HOE 32020 is one of Hoechst stains which are Bis-benzimides used as blue fluorescent dyes to stain DNA. |
| Appearance: | |
|---|---|
| Appearance | Solid Powder |
| Synonyms: | |
| Synonyms | 2-(4-chlorophenyl)-6-[6-(4-methylpiperazin-1-yl)-1-H-benzimidazol-2-yl]-1-H-benzimidazole |
| Storage: | |
| Storage | Store at -20°C |
| MSDS: | |
| MSDS | Inquire |
| Shelf Life: | |
| Shelf Life | 2 years |
| Boiling Point: | |
|---|---|
| Boiling Point | 715.6±70.0 °C | Condition: Press: 760 Torr |
| Density: | |
| Density | 1.356±0.06 g/cm3 |
| InChIKey: | |
| InChIKey | QXGLWDFFMBHOFL-UHFFFAOYSA-N |
| InChI: | |
| InChI | InChI=1S/C25H23ClN6/c1-31-10-12-32(13-11-31)19-7-9-21-23(15-19)30-25(28-21)17-4-8-20-22(14-17)29-24(27-20)16-2-5-18(26)6-3-16/h2-9,14-15H,10-13H2,1H3,(H,27,29)(H,28,30) |
| Canonical SMILES: | |
| Canonical SMILES | CN1CCN(CC1)C2=CC3=C(C=C2)N=C(N3)C4=CC5=C(C=C4)N=C(N5)C6=CC=C(C=C6)Cl |
Hoechst 33258 analog
(CAS: 258843-62-8)
An analog of Hoechst 33258. Hoechst 33258 is an iodinated DNA-binding bibenzimidazole, as well as a cell dye for DNA quantitation which sensitizes DNA and cells...
Ethidium monoazide bromide
(CAS: 58880-05-0)
Ethidium monoazide bromide is a fluorescent nucleic acid stain which binds covalently to nucleic acids both in solution and in cells.
Meta-iodoHoechst 33258
(CAS: 158013-42-4)
Meta-iodoHoechst 33258, an iodinated DNA-binding bibenzimidazole, is a cell dye for DNA quantitation which sensitizes DNA and cells to UVA.
HOE 32020
(CAS: 23554-99-6)
HOE 32020 is one of Hoechst stains which are Bis-benzimides used as blue fluorescent dyes to stain DNA.
PUR-1 is a probe for nucleic acid that exhibits enhanced fluorescence upon binding to DNA or RNA.
