Molecular Formula: | |
---|---|
Molecular Formula | C23H33N7O5S.C6H6O3S |
Molecular Weight: | |
Molecular Weight | 677.79 |
COA: | |
COA | Inquire |
Targets: | |
Targets | Phosphodiesterase (PDE) |
Description: | |
Description | Gisadenafil besylate is a potent PDE5 inhibitor (IC50 = 1.23 nM) with >100-fold selectivity for PDE5 over PDE6. Gisadenafil besylate inhibits the breakdown of cyclic phosphodiester secondary messenger molecules. |
Brife Description: | |
---|---|
Brife Description | PDE5 inhibitor |
Purity: | |
Purity | ≥99% by HPLC |
Synonyms: | |
Synonyms | UK 369003; UK369003; UK-369003; 5-[2-Ethoxy-5-[(4-ethyl-1-piperazinyl)sulfonyl]-3-pyridinyl]-3-ethyl-2,6-dihydro-2-(2-methoxyethyl)-7H-pyrazolo[4,3-d]pyrimidin-7-one benzenesulfonate |
MSDS: | |
MSDS | Inquire |
InChIKey: | |
---|---|
InChIKey | STFRDYSZKVPPQF-UHFFFAOYSA-N |
InChI: | |
InChI | InChI=1S/C23H33N7O5S.C6H6O3S/c1-5-18-19-20(27-30(18)12-13-34-4)22(31)26-21(25-19)17-14-16(15-24-23(17)35-7-3)36(32,33)29-10-8-28(6-2)9-11-29;7-10(8,9)6-4-2-1-3-5-6/h14-15H,5-13H2,1-4H3,(H,25,26,31);1-5H,(H,7,8,9) |
Canonical SMILES: | |
Canonical SMILES | CCC1=C2C(=NN1CCOC)C(=O)N=C(N2)C3=CC(=CN=C3OCC)S(=O)(=O)N4CCN(CC4)CC.C1=CC=C(C=C1)S(=O)(=O)O |
Chemical Structure