Molecular Formula: | |
---|---|
Molecular Formula | C22H17ClN6O |
Molecular Weight: | |
Molecular Weight | 416.86 |
COA: | |
COA | Inquire |
Targets: | |
Targets | PI3K |
Description: | |
Description | The R isomer analogue of Duvelisib which is a high selective PI3K δ/γ inhibitor. |
Purity: | |
---|---|
Purity | 95% |
Appearance: | |
Appearance | Powder |
Synonyms: | |
Synonyms | IPI-145 R enantiomer; IPI 145 R enantiomer; IPI145 R enantiomer; INK1197 R enantiomer; INK 1197 R enantiomer; INK-1197 R enantiomer |
Solubility: | |
Solubility | DMSO |
Storage: | |
Storage | -20ºC Freeze |
MSDS: | |
MSDS | Inquire |
Application: | |
Application | The R isomer analogue of Duvelisib which is a high selective PI3K δ/γ inhibitor. |
Shelf Life: | |
Shelf Life | As supplied, 2 years from the QC date provided on the Certificate of Analysis, when stored properly |
Quantity: | |
---|---|
Quantity | Milligrams-Grams |
InChIKey: | |
InChIKey | SJVQHLPISAIATJ-CYBMUJFWSA-N |
InChI: | |
InChI | InChI=1S/C22H17ClN6O/c1-13(28-21-19-20(25-11-24-19)26-12-27-21)17-10-14-6-5-9-16(23)18(14)22(30)29(17)15-7-3-2-4-8-15/h2-13H,1H3,(H2,24,25,26,27,28)/t13-/m1/s1 |
Canonical SMILES: | |
Canonical SMILES | CC(C1=CC2=C(C(=CC=C2)Cl)C(=O)N1C3=CC=CC=C3)NC4=NC=NC5=C4NC=N5 |