Molecular Formula: | |
---|---|
Molecular Formula | C20H22N4O |
Molecular Weight: | |
Molecular Weight | 334.415 |
COA: | |
COA | Inquire |
Description: | |
Description | Difenamizole is a non-steroidal anti-inflammatory drug (NSAID) and analgesic of the pyrazolone group related to metamizole. |
Purity: | |
---|---|
Purity | >98% |
Appearance: | |
Appearance | White solid |
Synonyms: | |
Synonyms | 2-(dimethylamino)-N-(2,5-diphenylpyrazol-3-yl)propanamide; Difenamizole; Difenamizole [INN]; Difenamizolum; BRN 0698538; Diphenamizole; Pasalin; UNII-24MR6YLL3W |
MSDS: | |
MSDS | Inquire |
InChIKey: | |
---|---|
InChIKey | PCXMKBOWWVXEDT-UHFFFAOYSA-N |
InChI: | |
InChI | 1S/C20H22N4O/c1-15(23(2)3)20(25)21-19-14-18(16-10-6-4-7-11-16)22-24(19)17-12-8-5-9-13-17/h4-15H,1-3H3,(H,21,25) |
Canonical SMILES: | |
Canonical SMILES | CC(C(=O)NC1=CC(=NN1C2=CC=CC=C2)C3=CC=CC=C3)N(C)C |
Chemical Structure