| Molecular Formula: | |
|---|---|
| Molecular Formula | C20H22N4O |
| Molecular Weight: | |
| Molecular Weight | 334.415 |
| COA: | |
| COA | Inquire |
| Description: | |
| Description | Difenamizole is a non-steroidal anti-inflammatory drug (NSAID) and analgesic of the pyrazolone group related to metamizole. |
| Purity: | |
|---|---|
| Purity | >98% |
| Appearance: | |
| Appearance | White solid |
| Synonyms: | |
| Synonyms | 2-(dimethylamino)-N-(2,5-diphenylpyrazol-3-yl)propanamide; Difenamizole; Difenamizole [INN]; Difenamizolum; BRN 0698538; Diphenamizole; Pasalin; UNII-24MR6YLL3W; BRN-0698538; BRN0698538 |
| MSDS: | |
| MSDS | Inquire |
| InChIKey: | |
|---|---|
| InChIKey | PCXMKBOWWVXEDT-UHFFFAOYSA-N |
| InChI: | |
| InChI | 1S/C20H22N4O/c1-15(23(2)3)20(25)21-19-14-18(16-10-6-4-7-11-16)22-24(19)17-12-8-5-9-13-17/h4-15H,1-3H3,(H,21,25) |
| Canonical SMILES: | |
| Canonical SMILES | CC(C(=O)NC1=CC(=NN1C2=CC=CC=C2)C3=CC=CC=C3)N(C)C |
Mitiglinide calcium
(CAS: 145525-41-3)
Aldioxa
(CAS: 5579-81-7)
Aldioxa is a gastrointestinal agent that improves delayed gastric emptying.
Temocapril
(CAS: 111902-57-9)
Reboxetine mesylate
(CAS: 71620-89-8)
Reboxetine mesylate is a potent and selective inhibitor of noradrenalin uptake (K i values are 1.1, 129 and > 10000 nM for rat NET, SERT and DAT respectively)....
Tamoxifen citrate
(CAS: 54965-24-1)
Agomelatine
(CAS: 138112-76-2)
Agomelatine is an atypical antidepressant marketed under the trade name Valdoxan, Melitor, Thymanax. It is used for the treatment of major depressive disorder. ...
3-Chloro-4-(3-fluorobenzyloxy) nitrobenz
(CAS: 443882-99-3)
R-(+)-Lansoprazole
(CAS: 138530-94-6)
Chemical Structure
