| Molecular Formula: | |
|---|---|
| Molecular Formula | C17H20N4OS.HCl |
| Molecular Weight: | |
| Molecular Weight | 364.89 |
| COA: | |
| COA | Inquire |
| Targets: | |
| Targets | mGluR |
| Description: | |
| Description | Desmethyl-YM 298198 is a derivative of YM 298198, a selective antagonist of mGlu1. |
| Brife Description: | |
|---|---|
| Brife Description | mGlu1 receptor antagonist |
| Purity: | |
| Purity | ≥98% by HPLC |
| Synonyms: | |
| Synonyms | 6-Amino-N-cyclohexyl-3-methylthiazolo[3,2-a]benzimidazole-2-carboxamide hydrochloride |
| MSDS: | |
| MSDS | Inquire |
| InChIKey: | |
|---|---|
| InChIKey | SWKZWXJQIDXGLX-UHFFFAOYSA-N |
| InChI: | |
| InChI | InChI=1S/C17H20N4OS.ClH/c1-10-15(16(22)19-12-5-3-2-4-6-12)23-17-20-13-8-7-11(18)9-14(13)21(10)17;/h7-9,12H,2-6,18H2,1H3,(H,19,22);1H |
| Canonical SMILES: | |
| Canonical SMILES | CC1=C(SC2=NC3=C(N12)C=C(C=C3)N)C(=O)NC4CCCCC4.Cl |
TCN238
(CAS: 125404-04-8)
TCN238 is an orally available, brain penetrant and positive allosteric mGlu4 receptor modulator (EC50= 1 μM) with 30-fold selectivity over mGluR5 using human re...
(RS)-3,5-DHPG
(CAS: 146255-66-5)
(RS)-3,5-DHPG is a group I metabotropic glutamate receptor agonist with selectivity for both mGluR1 and mGluR5. S-enantiomer (S)-3,5-DHPG is the active form.
RG7090
(CAS: 802906-73-6)
RG7090 is a negative modulator of metabotropic glutamate receptor subtype 5 (mGluR5; GRM5).
CTEP
(CAS: 871362-31-1)
CTEP is a novel, long-acting, orally bioavailable allosteric antagonist of mGlu5 receptor (IC50=2.2 nM), showing >1000-fold selectivity over other mGlu receptor...
ACPT-II
(CAS: 195209-04-2)
ACPT-II has been found to be a mGluR antagonist and could probably exhibit neuroprotective effects.
MTEP hydrochloride
(CAS: 1186195-60-7)
Glutamate, the major excitatory neurotransmitter in the brain, acts on both ionotropic and metabotropic glutamate receptors. Excessive metabotropic glutamate re...
BMT-145027
(CAS: 2018282-44-3)
BMT-145027 is a potent mGluR5 PAM without inherent agonist activity with an EC50 of 47 nM. BMT-145027 is a non-MPEP site PAM to demonstrate in vivo efficacy.
Mavoglurant
(CAS: 543906-09-8)
Mavoglurant is a structurally novel, non-competitive mGlu5 receptor antagonist (IC50=30 nM), as a a selective non-competitive antagonist.
Chemical Structure
