Molecular Formula: | |
---|---|
Molecular Formula | C18H24IN5NaO7P |
Molecular Weight: | |
Molecular Weight | 603.29 |
COA: | |
COA | Inquire |
Targets: | |
Targets | Others |
Description: | |
Description | CGP 55802A has been found to be a photoaffinity ligand that could be used to label NMDA receptor and have high selectivity to glutamate recognition site. |
Purity: | |
---|---|
Purity | 98% |
Appearance: | |
Appearance | Powder |
Synonyms: | |
Synonyms | Cgp-55802A; Cgp 55802A; (E)-2-Amino-10-((4-azido-2-hydroxy-3-iodobenzoyl)amino)-4-(phosphonomethyl)-3-decenoic acid monosodium salt; 152564-63-1; 2-Amino-10-((4-azido-2-hydroxy-3-iodobenzoyl)amino)-4-phosphonomethyl-dec-3-enoic acid sodium salt; 3-Decenoi |
Storage: | |
Storage | Store in a cool and dry place and at 0 - 4 °C for short term (days to weeks) or -20 °C for long term (months to years). |
MSDS: | |
MSDS | Inquire |
Quality Standard: | |
Quality Standard | In-house standard |
Quantity: | |
---|---|
Quantity | Milligram-Grams |
InChIKey: | |
InChIKey | FASKOKIDAZVESF-LBEJWNQZSA-M |
InChI: | |
InChI | InChI=1S/C18H25IN5O7P.Na/c19-15-14(23-24-21)7-6-12(16(15)25)17(26)22-8-4-2-1-3-5-11(10-32(29,30)31)9-13(20)18(27)28;/h6-7,9,13,25H,1-5,8,10,20H2,(H,22,26)(H,27,28)(H2,29,30,31);/q;+1/p-1/b11-9+; |
Canonical SMILES: | |
Canonical SMILES | C1=CC(=C(C(=C1C(=O)NCCCCCCC(=CC(C(=O)[O-])N)CP(=O)(O)O)O)I)N=[N+]=[N-].[Na+] |