Molecular Formula: | |
---|---|
Molecular Formula | C21H24N2O2 |
Molecular Weight: | |
Molecular Weight | 336.435 |
COA: | |
COA | Inquire |
Targets: | |
Targets | NF-κB |
Description: | |
Description | CBL0137 is a metabolically stable curaxin that activates p53 with an EC50 value of 0.37 µM and inhibits NF-κB with an EC50 of 0.47 µM. It also inhibits histone chaperone FACT (facilitates chromatin transcription) and MYC signal. |
Catalog Number | Size | Price | Stock | Quantity |
---|---|---|---|---|
B0084-284751 | 2.5 mg | $198 | In stock |
Synonyms: | |
---|---|
Synonyms | CBL-0137; Curaxin 137; 1,1'-(9-(2-(Isopropylamino)ethyl)-9H-carbazole-3,6-diyl)diethanone; 1-[6-acetyl-9-[2-(propan-2-ylamino)ethyl]carbazol-3-yl]ethanone |
MSDS: | |
MSDS | Inquire |
InChIKey: | |
---|---|
InChIKey | JKCSODVERGVDLT-UHFFFAOYSA-N |
InChI: | |
InChI | InChI=1S/C21H24N2O2/c1-13(2)22-9-10-23-20-7-5-16(14(3)24)11-18(20)19-12-17(15(4)25)6-8-21(19)23/h5-8,11-13,22H,9-10H2,1-4H3 |
Canonical SMILES: | |
Canonical SMILES | CC(C)NCCN1C2=C(C=C(C=C2)C(=O)C)C3=C1C=CC(=C3)C(=O)C |
Chemical Structure