Molecular Formula: | |
---|---|
Molecular Formula | C21H16FN7O |
Molecular Weight: | |
Molecular Weight | 401.405 |
COA: | |
COA | Inquire |
Targets: | |
Targets | PI3K |
Description: | |
Description | Acalisib, also known as GS-9820, is an inhibitor of the beta and delta isoforms of the 110 kDa catalytic subunit of class IA phosphoinositide-3 kinases (PI3K) with potential immunomodulating and antineoplastic activities. p110beta/delta PI3K inhibitor GS-9820 inhibits the activity of PI3K, thereby preventing the production of the second messenger phosphatidylinositol-3,4,5-trisphosphate (PIP3), which decreases tumor cell proliferation and induces cell death. PI3K-mediated signaling is often dysregulated in cancer cells; the targeted inhibition of PI3K is designed to preserve PI3K signaling in normal, non-neoplastic cells. |
Appearance: | |
---|---|
Appearance | Solid powder |
Synonyms: | |
Synonyms | GS-9820; GS9820; GS 9820; CAL-120; CAL 120; CAL120; Acalisib; UNII-OVW60IDW1D. |
MSDS: | |
MSDS | Inquire |
InChIKey: | |
---|---|
InChIKey | DOCINCLJNAXZQF-LBPRGKRZSA-N |
InChI: | |
InChI | InChI=1S/C21H16FN7O/c1-12(27-19-17-18(24-10-23-17)25-11-26-19)20-28-16-8-7-13(22)9-15(16)21(30)29(20)14-5-3-2-4-6-14/h2-12H,1H3,(H2,23,24,25,26,27)/t12-/m0/s1 |
Canonical SMILES: | |
Canonical SMILES | CC(C1=NC2=C(C=C(C=C2)F)C(=O)N1C3=CC=CC=C3)NC4=NC=NC5=C4NC=N5 |
Current Developer: | |
Current Developer | Gilead Sciences |
Chemical Structure