| Molecular Formula: | |
|---|---|
| Molecular Formula | C12H14N4O8 |
| Molecular Weight: | |
| Molecular Weight | 342.3 |
| COA: | |
| COA | Inquire |
| Application\Fluorophore: | |
| Application\Fluorophore | Cell and Organelle Stains |
| Description: | |
| Description | 2-NBDG is a fluorescent derivative of glucose that is used to monitor the glucose uptake into bacteria and live mammalian cells. |
| Purity: | |
|---|---|
| Purity | ≥98% |
| Appearance: | |
| Appearance | Solid Powder |
| Synonyms: | |
| Synonyms | NBD-Glucose; 2-deoxy-2-[(7-nitro-2,1,3-benzoxadiazol-4-yl)amino]-D-glucose; (2R,3R,4S,5R)-3,4,5,6-Tetrahydroxy-2-((7-nitrobenzo[c][1,2,5]oxadiazol-4-yl)amino)hexanal |
| Storage: | |
| Storage | Store at -20°C |
| MSDS: | |
| MSDS | Inquire |
| Excitation: | |
|---|---|
| Excitation | 475 nm |
| Emission: | |
| Emission | 550 nm |
| InChIKey: | |
| InChIKey | GVEBOQDOPLERMC-BGCUHRRXSA-N |
| InChI: | |
| InChI | InChI=1S/C12H14N4O8/c17-3-6-10(18)11(19)9(12(20)23-6)13-4-1-2-5(16(21)22)8-7(4)14-24-15-8/h1-2,6,9-13,17-20H,3H2/t6-,9-,10-,11-,12?/m1/s1 |
| Canonical SMILES: | |
| Canonical SMILES | C1=C(C2=NON=C2C(=C1)[N+](=O)[O-])NC(C=O)C(C(C(CO)O)O)O |
FBBBE is a derivative of fluorescein for imaging the production of intracellular hydrogen peroxide (H2O2).
3,3′-Diethyloxacarbocyanine iodide
(CAS: 905-96-4)
3,3′-Diethyloxacarbocyanine iodide is a lipophilic fluorescent stain for labeling membranes.
DiOC16(3)
(CAS: 161433-32-1)
DiI, DiO, DiD and DiR dyes are a family of lipophilic fluorescent stains for labeling membranes. The fluorescence of these environment-sensitive dyes is greatly...
SNARF-1, acetate, SE is an orange-red fluorescent dye used for long-term tracing of mixed cells.
CellTracker Blue CMF2HC Dye is a fluorescent dye for monitoring long-term cell location and movement for its stability in live cells.
6-Carboxyfluorescein diacetate
(CAS: 3348-03-6)
6-Carboxyfluorescein diacetate is a membrane-permeant prodrug of 6-Carboxyfluorescein, which has been used to differentiate viable cells from apoptotic cells.
4-(4-(dimethylamino)styryl)-n-methylpyri
(CAS: 959-81-9)
C6 NBD Galactosylceramide
(CAS: 170212-26-7)
C6 NBD galactosylceramide is a galactosylceramide derivative that is tagged with a fluorescent group C6 nitrobenzoxadiazole (C6 NBD). C6 NBD galactosylceramide ...
Chemical Structure
