Molecular Formula: | |
---|---|
Molecular Formula | C8H8O4 |
Molecular Weight: | |
Molecular Weight | 168.148 |
COA: | |
COA | Inquire |
Chemical Family: | |
Chemical Family | Quinones |
Description: | |
Description | 2,6-Dimethoxy-1,4-benzoquinone is a natural compound isolated from the barks of Liriodendron tulipifera. |
Purity: | |
---|---|
Purity | 98.0% |
Appearance: | |
Appearance | Yellow powder |
Synonyms: | |
Synonyms | 2,6-Dimethoxyquinone |
MSDS: | |
MSDS | Inquire |
InChIKey: | |
---|---|
InChIKey | OLBNOBQOQZRLMP-UHFFFAOYSA-N |
InChI: | |
InChI | InChI=1S/C8H8O4/c1-11-6-3-5(9)4-7(12-2)8(6)10/h3-4H,1-2H3 |
Canonical SMILES: | |
Canonical SMILES | COC1=CC(=O)C=C(C1=O)OC |
Chemical Structure