2,3-Dimethylbenzo[b]thiophene-7-boronic acid - CAS 475288-40-5

Quick Inquiry

Name:
* Email:
* Service & Products of Interest:
* Quantity:
* Verification code:
Please input "bocsci" as verification code.
Category
Main Product
Product Name
2,3-Dimethylbenzo[b]thiophene-7-boronic acid
Catalog Number
475288-40-5
Synonyms
2,3-DIMETHYLBENZO[B]THIOPHENE-7-BORONIC ACID; 2,3-DIMETHYL-1-BENZOTHIEN-7-YLBORONIC ACID
CAS Number
475288-40-5
Molecular Weight
206.06914
Molecular Formula
C10H11BO2S
COA
Inquire
MSDS
Inquire
Canonical SMILES
B(C1=C2C(=CC=C1)C(=C(S2)C)C)(O)O
InChI
InChI=1S/C10H11BO2S/c1-6-7(2)14-10-8(6)4-3-5-9(10)11(12)13/h3-5,12-13H,1-2H3
InChIKey
VWDREGUFPLPEPN-UHFFFAOYSA-N
Structure
CAS 475288-40-5 2,3-Dimethylbenzo[b]thiophene-7-boronic acid
Specification
Purity
95%
2005 - BOC Sciences | All rights reserved
BOCSciences
X CLOSE
BOCSciences
X CLOSE
BOCSciences
X CLOSE
BOCSciences
X CLOSE
BOCSciences
X CLOSE
BOCSciences
X CLOSE
BOCSciences
X CLOSE
BOCSciences
X CLOSE
BOCSciences
X CLOSE
BOCSciences
X CLOSE
BOCSciences
X CLOSE
BOCSciences
X CLOSE
BOCSciences
X CLOSE
BOCSciences
X CLOSE
BOCSciences
X CLOSE
BOCSciences
X CLOSE
BOCSciences
X CLOSE
BOCSciences
X CLOSE
BOCSciences
X CLOSE
BOCSciences
X CLOSE
BOCSciences
X CLOSE
BOCSciences
X CLOSE
BOCSciences
X CLOSE
BOCSciences
X CLOSE
DOWNLOAD